About 3-iminoisoindole-1,4-diamine
3-iminoisoindole-1,4-diamine (PubChem CID 173277790) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 3-iminoisoindole-1,4-diamine.
Molecular Properties
| Compound Name | 3-iminoisoindole-1,4-diamine |
| PubChem CID | 173277790 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-iminoisoindole-1,4-diamine |
| SMILES | [H]/N=C1\N=C(N)c2cccc(N)c21 |
| InChI | InChI=1S/C8H8N4/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H,9H2,(H3,10,11,12) |
| InChIKey | GZDBIKGPCAQICZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminoisoindole-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminoisoindole-1,4-diamine?
The IUPAC name of 3-iminoisoindole-1,4-diamine (CID 173277790) is 3-iminoisoindole-1,4-diamine.
What is the SMILES notation for 3-iminoisoindole-1,4-diamine?
The canonical SMILES for 3-iminoisoindole-1,4-diamine is [H]/N=C1\N=C(N)c2cccc(N)c21.
What is the InChIKey of 3-iminoisoindole-1,4-diamine?
The InChIKey is GZDBIKGPCAQICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3H,9H2,(H3,10,11,12).
What are the key properties of 3-iminoisoindole-1,4-diamine?
3-iminoisoindole-1,4-diamine has a molecular weight of 160.18 g/mol, XLogP of 0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminoisoindole-1,4-diamine is sourced from PubChem (CID 173277790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).