About 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine
4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine (PubChem CID 173278766) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine |
| PubChem CID | 173278766 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine |
| SMILES | FC1=CC=C(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C11H16FNO/c12-11-3-1-10(2-4-11)9-13-5-7-14-8-6-13/h1,3H,2,4-9H2 |
| InChIKey | FLADWEKVCVJCFB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine?
The IUPAC name of 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine (CID 173278766) is 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine.
What is the SMILES notation for 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine?
The canonical SMILES for 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine is FC1=CC=C(CN2CCOCC2)CC1.
What is the InChIKey of 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine?
The InChIKey is FLADWEKVCVJCFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO/c12-11-3-1-10(2-4-11)9-13-5-7-14-8-6-13/h1,3H,2,4-9H2.
What are the key properties of 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine?
4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine has a molecular weight of 197.25 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-fluorocyclohexa-1,3-dien-1-yl)methyl]morpholine is sourced from PubChem (CID 173278766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).