About silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate
silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate (PubChem CID 173278833) has the molecular formula C22H21AgO3P+
and a molecular weight of 472.25 g/mol. Its IUPAC name is silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate.
Molecular Properties
| Compound Name | silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate |
| PubChem CID | 173278833 |
| Molecular Formula | C22H21AgO3P+ |
| Molecular Weight | 472.25 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate |
| SMILES | O=C([O-])c1ccc(C(Cc2ccccc2)(Cc2ccccc2)O[PH3+])cc1.[Ag+] |
| InChI | InChI=1S/C22H21O3P.Ag/c23-21(24)19-11-13-20(14-12-19)22(25-26,15-17-7-3-1-4-8-17)16-18-9-5-2-6-10-18;/h1-14H,15-16H2,26H3;/q;+1 |
| InChIKey | SHQASZLNZPNIOX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate?
The IUPAC name of silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate (CID 173278833) is silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate.
What is the SMILES notation for silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate?
The canonical SMILES for silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate is O=C([O-])c1ccc(C(Cc2ccccc2)(Cc2ccccc2)O[PH3+])cc1.[Ag+].
What is the InChIKey of silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate?
The InChIKey is SHQASZLNZPNIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21O3P.Ag/c23-21(24)19-11-13-20(14-12-19)22(25-26,15-17-7-3-1-4-8-17)16-18-9-5-2-6-10-18;/h1-14H,15-16H2,26H3;/q;+1.
What are the key properties of silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate?
silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate has a molecular weight of 472.25 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 4-(1,3-diphenyl-2-phosphaniumyloxypropan-2-yl)benzoate is sourced from PubChem (CID 173278833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).