About 2,6-di(cyclooctyl)-1,2-dihydropyridine
2,6-di(cyclooctyl)-1,2-dihydropyridine (PubChem CID 173279074) has the molecular formula C21H35N
and a molecular weight of 301.52 g/mol. Its IUPAC name is 2,6-di(cyclooctyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-di(cyclooctyl)-1,2-dihydropyridine |
| PubChem CID | 173279074 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2,6-di(cyclooctyl)-1,2-dihydropyridine |
| SMILES | C1=CC(C2CCCCCCC2)NC(C2CCCCCCC2)=C1 |
| InChI | InChI=1S/C21H35N/c1-3-7-12-18(13-8-4-1)20-16-11-17-21(22-20)19-14-9-5-2-6-10-15-19/h11,16-20,22H,1-10,12-15H2 |
| InChIKey | UGUIUQJXMVSSOK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-di(cyclooctyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(cyclooctyl)-1,2-dihydropyridine?
The IUPAC name of 2,6-di(cyclooctyl)-1,2-dihydropyridine (CID 173279074) is 2,6-di(cyclooctyl)-1,2-dihydropyridine.
What is the SMILES notation for 2,6-di(cyclooctyl)-1,2-dihydropyridine?
The canonical SMILES for 2,6-di(cyclooctyl)-1,2-dihydropyridine is C1=CC(C2CCCCCCC2)NC(C2CCCCCCC2)=C1.
What is the InChIKey of 2,6-di(cyclooctyl)-1,2-dihydropyridine?
The InChIKey is UGUIUQJXMVSSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35N/c1-3-7-12-18(13-8-4-1)20-16-11-17-21(22-20)19-14-9-5-2-6-10-15-19/h11,16-20,22H,1-10,12-15H2.
What are the key properties of 2,6-di(cyclooctyl)-1,2-dihydropyridine?
2,6-di(cyclooctyl)-1,2-dihydropyridine has a molecular weight of 301.52 g/mol, XLogP of 6.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(cyclooctyl)-1,2-dihydropyridine is sourced from PubChem (CID 173279074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).