About fluoro(dioxido)borane;bis(rubidium(1+))
fluoro(dioxido)borane;bis(rubidium(1+)) (PubChem CID 173279295) has the molecular formula BFO2Rb2
and a molecular weight of 232.74 g/mol. Its IUPAC name is fluoro(dioxido)borane;bis(rubidium(1+)).
Molecular Properties
| Compound Name | fluoro(dioxido)borane;bis(rubidium(1+)) |
| PubChem CID | 173279295 |
| Molecular Formula | BFO2Rb2 |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 231.82 |
| IUPAC Name | fluoro(dioxido)borane;bis(rubidium(1+)) |
| SMILES | [O-]B([O-])F.[Rb+].[Rb+] |
| InChI | InChI=1S/BFO2.2Rb/c2-1(3)4;;/q-2;2*+1 |
| InChIKey | LFBHFULZFSTTPZ-UHFFFAOYSA-N |
| XLogP | -8.33 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | -8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoro(dioxido)borane;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(dioxido)borane;bis(rubidium(1+))?
The IUPAC name of fluoro(dioxido)borane;bis(rubidium(1+)) (CID 173279295) is fluoro(dioxido)borane;bis(rubidium(1+)).
What is the SMILES notation for fluoro(dioxido)borane;bis(rubidium(1+))?
The canonical SMILES for fluoro(dioxido)borane;bis(rubidium(1+)) is [O-]B([O-])F.[Rb+].[Rb+].
What is the InChIKey of fluoro(dioxido)borane;bis(rubidium(1+))?
The InChIKey is LFBHFULZFSTTPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/BFO2.2Rb/c2-1(3)4;;/q-2;2*+1.
What are the key properties of fluoro(dioxido)borane;bis(rubidium(1+))?
fluoro(dioxido)borane;bis(rubidium(1+)) has a molecular weight of 232.74 g/mol, XLogP of -8.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(dioxido)borane;bis(rubidium(1+)) is sourced from PubChem (CID 173279295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).