C14H16N2O4 — CID 173279426
1-(3-hydroxypiperidin-1-yl)-2-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 173279426) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-(3-hydroxypiperidin-1-yl)-2-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-(3-hydroxypiperidin-1-yl)-2-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173279426 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(3-hydroxypiperidin-1-yl)-2-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | C=C(C(=O)N1CCCC(O)C1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O4/c1-10(11-4-2-5-12(8-11)16(19)20)14(18)15-7-3-6-13(17)9-15/h2,4-5,8,13,17H,1,3,6-7,9H2 |
| InChIKey | PSNGUICSYBBNCD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|