C15H13F3N2O5S — CID 173279624
methyl 4-[3-(1H-imidazol-2-yl)prop-1-enyl]-2-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 173279624) has the molecular formula C15H13F3N2O5S and a molecular weight of 390.34 g/mol. Its IUPAC name is methyl 4-[3-(1H-imidazol-2-yl)prop-1-enyl]-2-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 4-[3-(1H-imidazol-2-yl)prop-1-enyl]-2-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 173279624 |
| Molecular Formula | C15H13F3N2O5S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | methyl 4-[3-(1H-imidazol-2-yl)prop-1-enyl]-2-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(C=CCc2ncc[nH]2)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O5S/c1-24-14(21)11-6-5-10(3-2-4-13-19-7-8-20-13)9-12(11)25-26(22,23)15(16,17)18/h2-3,5-9H,4H2,1H3,(H,19,20) |
| InChIKey | PIGVKQBRSDXIMQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|