About [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane
[cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane (PubChem CID 173280027) has the molecular formula C11H18OSi
and a molecular weight of 194.35 g/mol. Its IUPAC name is [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane.
Molecular Properties
| Compound Name | [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane |
| PubChem CID | 173280027 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane |
| SMILES | [SiH3]OC(C1=CC=CC1)C1CCCC1 |
| InChI | InChI=1S/C11H18OSi/c13-12-11(9-5-1-2-6-9)10-7-3-4-8-10/h1-2,5,10-11H,3-4,6-8H2,13H3 |
| InChIKey | GRXLURZAAFTHNR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane?
The IUPAC name of [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane (CID 173280027) is [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane.
What is the SMILES notation for [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane?
The canonical SMILES for [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane is [SiH3]OC(C1=CC=CC1)C1CCCC1.
What is the InChIKey of [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane?
The InChIKey is GRXLURZAAFTHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OSi/c13-12-11(9-5-1-2-6-9)10-7-3-4-8-10/h1-2,5,10-11H,3-4,6-8H2,13H3.
What are the key properties of [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane?
[cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane has a molecular weight of 194.35 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopenta-1,3-dien-1-yl(cyclopentyl)methoxy]silane is sourced from PubChem (CID 173280027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).