About 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide
1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide (PubChem CID 173280217) has the molecular formula C7H13BrN2
and a molecular weight of 205.10 g/mol. Its IUPAC name is 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide.
Molecular Properties
| Compound Name | 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide |
| PubChem CID | 173280217 |
| Molecular Formula | C7H13BrN2 |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide |
| SMILES | Br.[H]/N=C(\CC)N1C=CCC1 |
| InChI | InChI=1S/C7H12N2.BrH/c1-2-7(8)9-5-3-4-6-9;/h3,5,8H,2,4,6H2,1H3;1H/b8-7+; |
| InChIKey | PHPYXLRVPVYLIV-USRGLUTNSA-N |
| XLogP | 2.17 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide?
The IUPAC name of 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide (CID 173280217) is 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide.
What is the SMILES notation for 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide?
The canonical SMILES for 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide is Br.[H]/N=C(\CC)N1C=CCC1.
What is the InChIKey of 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide?
The InChIKey is PHPYXLRVPVYLIV-USRGLUTNSA-N. The full InChI is InChI=1S/C7H12N2.BrH/c1-2-7(8)9-5-3-4-6-9;/h3,5,8H,2,4,6H2,1H3;1H/b8-7+;.
What are the key properties of 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide?
1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide has a molecular weight of 205.10 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydropyrrol-1-yl)propan-1-imine;hydrobromide is sourced from PubChem (CID 173280217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).