About 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide
2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 173280889) has the molecular formula C9H10N4OS
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| PubChem CID | 173280889 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CN1C=CC=CC1)Nc1nncs1 |
| InChI | InChI=1S/C9H10N4OS/c14-8(11-9-12-10-7-15-9)6-13-4-2-1-3-5-13/h1-4,7H,5-6H2,(H,11,12,14) |
| InChIKey | HBSGDUOGEABOPB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide?
The IUPAC name of 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide (CID 173280889) is 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide.
What is the SMILES notation for 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide?
The canonical SMILES for 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide is O=C(CN1C=CC=CC1)Nc1nncs1.
What is the InChIKey of 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide?
The InChIKey is HBSGDUOGEABOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS/c14-8(11-9-12-10-7-15-9)6-13-4-2-1-3-5-13/h1-4,7H,5-6H2,(H,11,12,14).
What are the key properties of 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide?
2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide has a molecular weight of 222.27 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-pyridin-1-yl)-N-(1,3,4-thiadiazol-2-yl)acetamide is sourced from PubChem (CID 173280889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).