C21H33N3O4SSi — CID 173280933
prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy-(5-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 173280933) has the molecular formula C21H33N3O4SSi and a molecular weight of 451.67 g/mol. Its IUPAC name is prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy-(5-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy-(5-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173280933 |
| Molecular Formula | C21H33N3O4SSi |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy-(5-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C(O[SiH](C)C)[C@@H](C(C)(C)C)C[C@H]1C(O)c1cn2c(C)ncc2s1 |
| InChI | InChI=1S/C21H33N3O4SSi/c1-8-9-27-20(26)24-15(10-14(21(3,4)5)19(24)28-30(6)7)18(25)16-12-23-13(2)22-11-17(23)29-16/h8,11-12,14-15,18-19,25,30H,1,9-10H2,2-7H3/t14-,15-,18?,19?/m0/s1 |
| InChIKey | NOYQXKCAZBIPHP-GKVPXEHWSA-N |
| XLogP | 4.12 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|