About methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate
methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate (PubChem CID 173281118) has the molecular formula C37H74N2O6
and a molecular weight of 643.01 g/mol. Its IUPAC name is methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate.
Molecular Properties
| Compound Name | methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate |
| PubChem CID | 173281118 |
| Molecular Formula | C37H74N2O6 |
| Molecular Weight | 643.01 g/mol |
| Exact Mass | 642.55 |
| IUPAC Name | methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate |
| SMILES | CCCCCCCCCCCOC(=O)CCCCCN(C)C(=O)O.CCCCCCCCCCCOC(=O)N(C)CCCCC |
| InChI | InChI=1S/C19H37NO4.C18H37NO2/c1-3-4-5-6-7-8-9-10-14-17-24-18(21)15-12-11-13-16-20(2)19(22)23;1-4-6-8-9-10-11-12-13-15-17-21-18(20)19(3)16-14-7-5-2/h3-17H2,1-2H3,(H,22,23);4-17H2,1-3H3 |
| InChIKey | LKYLDCMYRCFCIR-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.01 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate?
The IUPAC name of methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate (CID 173281118) is methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate.
What is the SMILES notation for methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate?
The canonical SMILES for methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate is CCCCCCCCCCCOC(=O)CCCCCN(C)C(=O)O.CCCCCCCCCCCOC(=O)N(C)CCCCC.
What is the InChIKey of methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate?
The InChIKey is LKYLDCMYRCFCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO4.C18H37NO2/c1-3-4-5-6-7-8-9-10-14-17-24-18(21)15-12-11-13-16-20(2)19(22)23;1-4-6-8-9-10-11-12-13-15-17-21-18(20)19(3)16-14-7-5-2/h3-17H2,1-2H3,(H,22,23);4-17H2,1-3H3.
What are the key properties of methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate?
methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate has a molecular weight of 643.01 g/mol, XLogP of 11.01, 30 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(6-oxo-6-undecoxyhexyl)carbamic acid;undecyl N-methyl-N-pentylcarbamate is sourced from PubChem (CID 173281118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).