About cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium
cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium (PubChem CID 173281813) has the molecular formula C12H10Ru-6
and a molecular weight of 255.28 g/mol. Its IUPAC name is cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium.
Molecular Properties
| Compound Name | cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium |
| PubChem CID | 173281813 |
| Molecular Formula | C12H10Ru-6 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium |
| SMILES | C#C[c-]1cccc1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C7H5.C5H5.Ru/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h1,3-6H;1-5H;/q-1;-5; |
| InChIKey | QTGUWQYPXLRGKK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium?
The IUPAC name of cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium (CID 173281813) is cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium.
What is the SMILES notation for cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium?
The canonical SMILES for cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium is C#C[c-]1cccc1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium?
The InChIKey is QTGUWQYPXLRGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5.C5H5.Ru/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h1,3-6H;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium?
cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium has a molecular weight of 255.28 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;5-ethynylcyclopenta-1,3-diene;ruthenium is sourced from PubChem (CID 173281813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).