About cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene
cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene (PubChem CID 173282363) has the molecular formula C15H16Fe-6
and a molecular weight of 252.14 g/mol. Its IUPAC name is cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene |
| PubChem CID | 173282363 |
| Molecular Formula | C15H16Fe-6 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene |
| SMILES | C=CC=C(C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C10H11.C5H5.Fe/c1-3-6-9(2)10-7-4-5-8-10;1-2-4-5-3-1;/h3-8H,1H2,2H3;1-5H;/q-1;-5; |
| InChIKey | SJVYMMXDGNVBHB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene?
The IUPAC name of cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene (CID 173282363) is cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene.
What is the SMILES notation for cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene?
The canonical SMILES for cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene is C=CC=C(C)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene?
The InChIKey is SJVYMMXDGNVBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11.C5H5.Fe/c1-3-6-9(2)10-7-4-5-8-10;1-2-4-5-3-1;/h3-8H,1H2,2H3;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene?
cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene has a molecular weight of 252.14 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;iron;5-penta-2,4-dien-2-ylcyclopenta-1,3-diene is sourced from PubChem (CID 173282363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).