About 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane
3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane (PubChem CID 173282386) has the molecular formula C5H16O3Si2
and a molecular weight of 180.35 g/mol. Its IUPAC name is 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane.
Molecular Properties
| Compound Name | 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane |
| PubChem CID | 173282386 |
| Molecular Formula | C5H16O3Si2 |
| Molecular Weight | 180.35 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane |
| SMILES | CC1(C)OC1O.C[SiH2]O[SiH3] |
| InChI | InChI=1S/C4H8O2.CH8OSi2/c1-4(2)3(5)6-4;1-4-2-3/h3,5H,1-2H3;4H2,1,3H3 |
| InChIKey | ILDZOTJPHMSVTD-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.35 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane?
The IUPAC name of 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane (CID 173282386) is 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane.
What is the SMILES notation for 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane?
The canonical SMILES for 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane is CC1(C)OC1O.C[SiH2]O[SiH3].
What is the InChIKey of 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane?
The InChIKey is ILDZOTJPHMSVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.CH8OSi2/c1-4(2)3(5)6-4;1-4-2-3/h3,5H,1-2H3;4H2,1,3H3.
What are the key properties of 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane?
3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane has a molecular weight of 180.35 g/mol, XLogP of -1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyloxiran-2-ol;methyl(silyloxy)silane is sourced from PubChem (CID 173282386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).