bis(2-hydrazinylethanol);sulfuric acid

C4H18N4O6S — CID 173282474

IUPACbis(2-hydrazinylethanol);sulfuric acid
SMILESNNCCO.NNCCO.O=S(=O)(O)O
InChIInChI=1S/2C2H8N2O.H2O4S/c2*3-4-1-2-5;1-5(2,3)4/h2*4-5H,1-3H2;(H2,1,2,3,4)
InChIKeyQTOHAOXZJPXLHC-UHFFFAOYSA-N
MW250.28 g/mol
LogP-3.77
Rot. Bonds4

About bis(2-hydrazinylethanol);sulfuric acid

bis(2-hydrazinylethanol);sulfuric acid (PubChem CID 173282474) has the molecular formula C4H18N4O6S and a molecular weight of 250.28 g/mol. Its IUPAC name is bis(2-hydrazinylethanol);sulfuric acid.

Molecular Properties

Compound Namebis(2-hydrazinylethanol);sulfuric acid
PubChem CID173282474
Molecular FormulaC4H18N4O6S
Molecular Weight250.28 g/mol
Exact Mass250.09
IUPAC Namebis(2-hydrazinylethanol);sulfuric acid
SMILESNNCCO.NNCCO.O=S(=O)(O)O
InChIInChI=1S/2C2H8N2O.H2O4S/c2*3-4-1-2-5;1-5(2,3)4/h2*4-5H,1-3H2;(H2,1,2,3,4)
InChIKeyQTOHAOXZJPXLHC-UHFFFAOYSA-N
XLogP-3.77
TPSA191.16 Ų
H-Bond Donors8
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500250.28
LogP ≤ 5-3.77
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze bis(2-hydrazinylethanol);sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-hydrazinylethanol);sulfuric acid?
The IUPAC name of bis(2-hydrazinylethanol);sulfuric acid (CID 173282474) is bis(2-hydrazinylethanol);sulfuric acid.
What is the SMILES notation for bis(2-hydrazinylethanol);sulfuric acid?
The canonical SMILES for bis(2-hydrazinylethanol);sulfuric acid is NNCCO.NNCCO.O=S(=O)(O)O.
What is the InChIKey of bis(2-hydrazinylethanol);sulfuric acid?
The InChIKey is QTOHAOXZJPXLHC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H8N2O.H2O4S/c2*3-4-1-2-5;1-5(2,3)4/h2*4-5H,1-3H2;(H2,1,2,3,4).
What are the key properties of bis(2-hydrazinylethanol);sulfuric acid?
bis(2-hydrazinylethanol);sulfuric acid has a molecular weight of 250.28 g/mol, XLogP of -3.77, 4 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydrazinylethanol);sulfuric acid is sourced from PubChem (CID 173282474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).