C32H50N4O5 — CID 173283191
(2S,3R)-5-methyl-3-[(2-methylpropylamino)carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-(2-pyrrolidin-1-ylacetyl)hexanamide (PubChem CID 173283191) has the molecular formula C32H50N4O5 and a molecular weight of 570.78 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-[(2-methylpropylamino)carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-(2-pyrrolidin-1-ylacetyl)hexanamide.
| Compound Name | (2S,3R)-5-methyl-3-[(2-methylpropylamino)carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-(2-pyrrolidin-1-ylacetyl)hexanamide |
|---|---|
| PubChem CID | 173283191 |
| Molecular Formula | C32H50N4O5 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | (2S,3R)-5-methyl-3-[(2-methylpropylamino)carbamoyl]-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)-3-(2-pyrrolidin-1-ylacetyl)hexanamide |
| SMILES | CC(C)CNNC(=O)[C@@](CC(C)C)(C(=O)CN1CCCC1)[C@H](CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C32H50N4O5/c1-24(2)21-32(31(39)34-33-22-25(3)4,28(37)23-36-18-9-10-19-36)27(16-12-15-26-13-6-5-7-14-26)30(38)35-41-29-17-8-11-20-40-29/h5-7,12-15,24-25,27,29,33H,8-11,16-23H2,1-4H3,(H,34,39)(H,35,38)/t27-,29?,32-/m1/s1 |
| InChIKey | ABIPBVXMEMOIAM-VPQXSCEVSA-N |
| XLogP | 4.25 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|