C14H16F10O2S — CID 173284662
6,6,7,7,7-pentafluoro-1-(6,6,7,7,7-pentafluorohept-1-enylsulfonyl)hept-1-ene (PubChem CID 173284662) has the molecular formula C14H16F10O2S and a molecular weight of 438.33 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-1-(6,6,7,7,7-pentafluorohept-1-enylsulfonyl)hept-1-ene.
| Compound Name | 6,6,7,7,7-pentafluoro-1-(6,6,7,7,7-pentafluorohept-1-enylsulfonyl)hept-1-ene |
|---|---|
| PubChem CID | 173284662 |
| Molecular Formula | C14H16F10O2S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-1-(6,6,7,7,7-pentafluorohept-1-enylsulfonyl)hept-1-ene |
| SMILES | O=S(=O)(C=CCCCC(F)(F)C(F)(F)F)C=CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F10O2S/c15-11(16,13(19,20)21)7-3-1-5-9-27(25,26)10-6-2-4-8-12(17,18)14(22,23)24/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | ZROCGBKUFYQYOE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|