About 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid
4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid (PubChem CID 173284921) has the molecular formula C32H30O4P2
and a molecular weight of 540.54 g/mol. Its IUPAC name is 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid |
| PubChem CID | 173284921 |
| Molecular Formula | C32H30O4P2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid |
| SMILES | CCC(C)OC(=O)C(=C(C(=O)O)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30O4P2/c1-3-24(2)36-32(35)30(38(27-20-12-6-13-21-27)28-22-14-7-15-23-28)29(31(33)34)37(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h4-24H,3H2,1-2H3,(H,33,34) |
| InChIKey | NDEOOYOEKBYOPD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid?
The IUPAC name of 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid (CID 173284921) is 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid is CCC(C)OC(=O)C(=C(C(=O)O)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid?
The InChIKey is NDEOOYOEKBYOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H30O4P2/c1-3-24(2)36-32(35)30(38(27-20-12-6-13-21-27)28-22-14-7-15-23-28)29(31(33)34)37(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h4-24H,3H2,1-2H3,(H,33,34).
What are the key properties of 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid?
4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid has a molecular weight of 540.54 g/mol, XLogP of 5.89, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yloxy-2,3-bis(diphenylphosphanyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 173284921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).