C16H20ClN3O5 — CID 173285467
2-[(4S)-4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride (PubChem CID 173285467) has the molecular formula C16H20ClN3O5 and a molecular weight of 369.81 g/mol. Its IUPAC name is 2-[(4S)-4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride.
| Compound Name | 2-[(4S)-4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 173285467 |
| Molecular Formula | C16H20ClN3O5 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-[(4S)-4-[4-(ethoxyiminomethyl)phenyl]-3,4-dimethyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride |
| SMILES | CCON=Cc1ccc([C@@]2(C)C(=O)N(CC(=O)O)C(=O)N2C)cc1.Cl |
| InChI | InChI=1S/C16H19N3O5.ClH/c1-4-24-17-9-11-5-7-12(8-6-11)16(2)14(22)19(10-13(20)21)15(23)18(16)3;/h5-9H,4,10H2,1-3H3,(H,20,21);1H/t16-;/m0./s1 |
| InChIKey | WDYGRMXHSXBEGE-NTISSMGPSA-N |
| XLogP | 1.67 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|