About 4-(3-chloropropoxy)-2,3-dimethylpyridine
4-(3-chloropropoxy)-2,3-dimethylpyridine (PubChem CID 173285585) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 4-(3-chloropropoxy)-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 4-(3-chloropropoxy)-2,3-dimethylpyridine |
| PubChem CID | 173285585 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-(3-chloropropoxy)-2,3-dimethylpyridine |
| SMILES | Cc1nccc(OCCCCl)c1C |
| InChI | InChI=1S/C10H14ClNO/c1-8-9(2)12-6-4-10(8)13-7-3-5-11/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | ODQRGUUSAMNJJG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropoxy)-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropoxy)-2,3-dimethylpyridine?
The IUPAC name of 4-(3-chloropropoxy)-2,3-dimethylpyridine (CID 173285585) is 4-(3-chloropropoxy)-2,3-dimethylpyridine.
What is the SMILES notation for 4-(3-chloropropoxy)-2,3-dimethylpyridine?
The canonical SMILES for 4-(3-chloropropoxy)-2,3-dimethylpyridine is Cc1nccc(OCCCCl)c1C.
What is the InChIKey of 4-(3-chloropropoxy)-2,3-dimethylpyridine?
The InChIKey is ODQRGUUSAMNJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO/c1-8-9(2)12-6-4-10(8)13-7-3-5-11/h4,6H,3,5,7H2,1-2H3.
What are the key properties of 4-(3-chloropropoxy)-2,3-dimethylpyridine?
4-(3-chloropropoxy)-2,3-dimethylpyridine has a molecular weight of 199.68 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropoxy)-2,3-dimethylpyridine is sourced from PubChem (CID 173285585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).