C30H32N6O6 — CID 173285706
bis[1-[3-[3-(1H-imidazol-5-yl)propoxy]phenyl]ethylideneamino] oxalate (PubChem CID 173285706) has the molecular formula C30H32N6O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is bis[1-[3-[3-(1H-imidazol-5-yl)propoxy]phenyl]ethylideneamino] oxalate.
| Compound Name | bis[1-[3-[3-(1H-imidazol-5-yl)propoxy]phenyl]ethylideneamino] oxalate |
|---|---|
| PubChem CID | 173285706 |
| Molecular Formula | C30H32N6O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | bis[1-[3-[3-(1H-imidazol-5-yl)propoxy]phenyl]ethylideneamino] oxalate |
| SMILES | CC(=NOC(=O)C(=O)ON=C(C)c1cccc(OCCCc2cnc[nH]2)c1)c1cccc(OCCCc2cnc[nH]2)c1 |
| InChI | InChI=1S/C30H32N6O6/c1-21(23-7-3-11-27(15-23)39-13-5-9-25-17-31-19-33-25)35-41-29(37)30(38)42-36-22(2)24-8-4-12-28(16-24)40-14-6-10-26-18-32-20-34-26/h3-4,7-8,11-12,15-20H,5-6,9-10,13-14H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | DHNQWYHFNRAVFQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|