About 3-diazo-4,5-dihydroanthracene-1,9-dione
3-diazo-4,5-dihydroanthracene-1,9-dione (PubChem CID 173285901) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-diazo-4,5-dihydroanthracene-1,9-dione.
Molecular Properties
| Compound Name | 3-diazo-4,5-dihydroanthracene-1,9-dione |
| PubChem CID | 173285901 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-diazo-4,5-dihydroanthracene-1,9-dione |
| SMILES | [N-]=[N+]=C1CC(=O)C2=C(C=C3CC=CC=C3C2=O)C1 |
| InChI | InChI=1S/C14H10N2O2/c15-16-10-6-9-5-8-3-1-2-4-11(8)14(18)13(9)12(17)7-10/h1-2,4-5H,3,6-7H2 |
| InChIKey | RTFAMZQYEWYFSW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazo-4,5-dihydroanthracene-1,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazo-4,5-dihydroanthracene-1,9-dione?
The IUPAC name of 3-diazo-4,5-dihydroanthracene-1,9-dione (CID 173285901) is 3-diazo-4,5-dihydroanthracene-1,9-dione.
What is the SMILES notation for 3-diazo-4,5-dihydroanthracene-1,9-dione?
The canonical SMILES for 3-diazo-4,5-dihydroanthracene-1,9-dione is [N-]=[N+]=C1CC(=O)C2=C(C=C3CC=CC=C3C2=O)C1.
What is the InChIKey of 3-diazo-4,5-dihydroanthracene-1,9-dione?
The InChIKey is RTFAMZQYEWYFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c15-16-10-6-9-5-8-3-1-2-4-11(8)14(18)13(9)12(17)7-10/h1-2,4-5H,3,6-7H2.
What are the key properties of 3-diazo-4,5-dihydroanthracene-1,9-dione?
3-diazo-4,5-dihydroanthracene-1,9-dione has a molecular weight of 238.25 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazo-4,5-dihydroanthracene-1,9-dione is sourced from PubChem (CID 173285901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).