C38H40N12Na2O8S2 — CID 173286332
CID 173286332 (PubChem CID 173286332) has the molecular formula C38H40N12Na2O8S2 and a molecular weight of 902.93 g/mol.
| Compound Name | CID 173286332 |
|---|---|
| PubChem CID | 173286332 |
| Molecular Formula | C38H40N12Na2O8S2 |
| Molecular Weight | 902.93 g/mol |
| Exact Mass | 902.23 |
| IUPAC Name | — |
| SMILES | CN(CCO)c1nc(Nc2ccccc2)nc(Nc2ccc(C=Cc3ccccc3S(=O)(=O)O)c(S(=O)(=O)O)c2Nc2nc(Nc3ccccc3)nc(N(C)CCO)n2)n1.[Na].[Na] |
| InChI | InChI=1S/C38H40N12O8S2.2Na/c1-49(21-23-51)37-45-33(39-27-12-5-3-6-13-27)43-35(47-37)41-29-20-19-26(18-17-25-11-9-10-16-30(25)59(53,54)55)32(60(56,57)58)31(29)42-36-44-34(40-28-14-7-4-8-15-28)46-38(48-36)50(2)22-24-52;;/h3-20,51-52H,21-24H2,1-2H3,(H,53,54,55)(H,56,57,58)(H2,39,41,43,45,47)(H2,40,42,44,46,48);; |
| InChIKey | YYUINAYMTMJLCF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 281.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|