C13H20NNaO2S — CID 173287382
sodium;hydride;(2S)-2-[N-(4-sulfanylbutyl)anilino]propanoic acid (PubChem CID 173287382) has the molecular formula C13H20NNaO2S and a molecular weight of 277.36 g/mol. Its IUPAC name is sodium;hydride;(2S)-2-[N-(4-sulfanylbutyl)anilino]propanoic acid.
| Compound Name | sodium;hydride;(2S)-2-[N-(4-sulfanylbutyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 173287382 |
| Molecular Formula | C13H20NNaO2S |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | sodium;hydride;(2S)-2-[N-(4-sulfanylbutyl)anilino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(CCCCS)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C13H19NO2S.Na.H/c1-11(13(15)16)14(9-5-6-10-17)12-7-3-2-4-8-12;;/h2-4,7-8,11,17H,5-6,9-10H2,1H3,(H,15,16);;/q;+1;-1/t11-;;/m0../s1 |
| InChIKey | YGZKAGANZVAWRG-IDMXKUIJSA-N |
| XLogP | -0.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|