About 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate
2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate (PubChem CID 173288500) has the molecular formula C12H23NO3Sn
and a molecular weight of 348.03 g/mol. Its IUPAC name is 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate.
Molecular Properties
| Compound Name | 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate |
| PubChem CID | 173288500 |
| Molecular Formula | C12H23NO3Sn |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate |
| SMILES | CC(N)c1occc1CC[SnH+2].CC[O-].CC[O-] |
| InChI | InChI=1S/C8H12NO.2C2H5O.Sn.H/c1-3-7-4-5-10-8(7)6(2)9;2*1-2-3;;/h4-6H,1,3,9H2,2H3;2*2H2,1H3;;/q;2*-1;+2; |
| InChIKey | XKLCBWGZLMFVKI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate?
The IUPAC name of 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate (CID 173288500) is 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate.
What is the SMILES notation for 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate?
The canonical SMILES for 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate is CC(N)c1occc1CC[SnH+2].CC[O-].CC[O-].
What is the InChIKey of 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate?
The InChIKey is XKLCBWGZLMFVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12NO.2C2H5O.Sn.H/c1-3-7-4-5-10-8(7)6(2)9;2*1-2-3;;/h4-6H,1,3,9H2,2H3;2*2H2,1H3;;/q;2*-1;+2;.
What are the key properties of 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate?
2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate has a molecular weight of 348.03 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-aminoethyl)furan-3-yl]ethyl-hydridotin(2+);ethanolate is sourced from PubChem (CID 173288500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).