C34H40N4O8 — CID 173288622
[(2S)-2-amino-2-[(1R)-1-phenylethoxy]acetyl] 7-[phenylmethoxycarbonyl-(N-phenylmethoxycarbonylcarbamimidoyl)amino]heptanoate (PubChem CID 173288622) has the molecular formula C34H40N4O8 and a molecular weight of 632.71 g/mol. Its IUPAC name is [(2S)-2-amino-2-[(1R)-1-phenylethoxy]acetyl] 7-[phenylmethoxycarbonyl-(N-phenylmethoxycarbonylcarbamimidoyl)amino]heptanoate.
| Compound Name | [(2S)-2-amino-2-[(1R)-1-phenylethoxy]acetyl] 7-[phenylmethoxycarbonyl-(N-phenylmethoxycarbonylcarbamimidoyl)amino]heptanoate |
|---|---|
| PubChem CID | 173288622 |
| Molecular Formula | C34H40N4O8 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | [(2S)-2-amino-2-[(1R)-1-phenylethoxy]acetyl] 7-[phenylmethoxycarbonyl-(N-phenylmethoxycarbonylcarbamimidoyl)amino]heptanoate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)N(CCCCCCC(=O)OC(=O)[C@@H](N)O[C@H](C)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H40N4O8/c1-25(28-19-11-6-12-20-28)45-30(35)31(40)46-29(39)21-13-2-3-14-22-38(34(42)44-24-27-17-9-5-10-18-27)32(36)37-33(41)43-23-26-15-7-4-8-16-26/h4-12,15-20,25,30H,2-3,13-14,21-24,35H2,1H3,(H2,36,37,41)/t25-,30+/m1/s1 |
| InChIKey | ZULCMOYNSAVUSB-RNAHPLFWSA-N |
| XLogP | 5.57 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|