About potassium;hexabromorhodium;hydride
potassium;hexabromorhodium;hydride (PubChem CID 173288783) has the molecular formula HBr6KRh
and a molecular weight of 622.44 g/mol. Its IUPAC name is potassium;hexabromorhodium;hydride.
Molecular Properties
| Compound Name | potassium;hexabromorhodium;hydride |
| PubChem CID | 173288783 |
| Molecular Formula | HBr6KRh |
| Molecular Weight | 622.44 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | potassium;hexabromorhodium;hydride |
| SMILES | Br[Rh](Br)(Br)(Br)(Br)Br.[H-].[K+] |
| InChI | InChI=1S/6BrH.K.Rh.H/h6*1H;;;/q;;;;;;+1;+6;-1/p-6 |
| InChIKey | PFQNLPATZUYMDX-UHFFFAOYSA-H |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 622.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium;hexabromorhodium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hexabromorhodium;hydride?
The IUPAC name of potassium;hexabromorhodium;hydride (CID 173288783) is potassium;hexabromorhodium;hydride.
What is the SMILES notation for potassium;hexabromorhodium;hydride?
The canonical SMILES for potassium;hexabromorhodium;hydride is Br[Rh](Br)(Br)(Br)(Br)Br.[H-].[K+].
What is the InChIKey of potassium;hexabromorhodium;hydride?
The InChIKey is PFQNLPATZUYMDX-UHFFFAOYSA-H. The full InChI is InChI=1S/6BrH.K.Rh.H/h6*1H;;;/q;;;;;;+1;+6;-1/p-6.
What are the key properties of potassium;hexabromorhodium;hydride?
potassium;hexabromorhodium;hydride has a molecular weight of 622.44 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hexabromorhodium;hydride is sourced from PubChem (CID 173288783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).