C17H30O — CID 173288957
(1Z)-4-ethenyl-8-methyl-1-pentoxynona-1,7-diene (PubChem CID 173288957) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (1Z)-4-ethenyl-8-methyl-1-pentoxynona-1,7-diene.
| Compound Name | (1Z)-4-ethenyl-8-methyl-1-pentoxynona-1,7-diene |
|---|---|
| PubChem CID | 173288957 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (1Z)-4-ethenyl-8-methyl-1-pentoxynona-1,7-diene |
| SMILES | C=CC(C/C=C\OCCCCC)CCC=C(C)C |
| InChI | InChI=1S/C17H30O/c1-5-7-8-14-18-15-10-13-17(6-2)12-9-11-16(3)4/h6,10-11,15,17H,2,5,7-9,12-14H2,1,3-4H3/b15-10- |
| InChIKey | MLMGRTYSFZOCEM-GDNBJRDFSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|