C3H17NO20P7+ — CID 173288997
[[bis(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid;hydroxy(oxo)phosphanium (PubChem CID 173288997) has the molecular formula C3H17NO20P7+ and a molecular weight of 603.97 g/mol. Its IUPAC name is [[bis(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid;hydroxy(oxo)phosphanium.
| Compound Name | [[bis(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid;hydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 173288997 |
| Molecular Formula | C3H17NO20P7+ |
| Molecular Weight | 603.97 g/mol |
| Exact Mass | 603.85 |
| IUPAC Name | [[bis(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid;hydroxy(oxo)phosphanium |
| SMILES | O=P(O)(O)C(N(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O)P(=O)(O)O.O=[PH+]O |
| InChI | InChI=1S/C3H15NO18P6.HO2P/c5-23(6,7)1(24(8,9)10)4(2(25(11,12)13)26(14,15)16)3(27(17,18)19)28(20,21)22;1-3-2/h1-3H,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22);3H/p+1 |
| InChIKey | AVDQOGFTYJMDAZ-UHFFFAOYSA-O |
| XLogP | -2.88 |
| TPSA | 385.72 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.97 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|