C30H30Cl2N3O2P — CID 173289234
triphenylphosphane;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;dihydrochloride (PubChem CID 173289234) has the molecular formula C30H30Cl2N3O2P and a molecular weight of 566.47 g/mol. Its IUPAC name is triphenylphosphane;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;dihydrochloride.
| Compound Name | triphenylphosphane;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 173289234 |
| Molecular Formula | C30H30Cl2N3O2P |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | triphenylphosphane;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H13N3O2.2ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;;/h1-15H;7H,1-6H2;2*1H |
| InChIKey | CPFMPDZLZQVHFY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|