About dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride
dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride (PubChem CID 173289706) has the molecular formula C10H20Li2N2O2
and a molecular weight of 214.16 g/mol. Its IUPAC name is dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride.
Molecular Properties
| Compound Name | dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride |
| PubChem CID | 173289706 |
| Molecular Formula | C10H20Li2N2O2 |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride |
| SMILES | CC1(C)CC(NC=O)CC(NC=O)C1.[H-].[H-].[Li+].[Li+] |
| InChI | InChI=1S/C10H18N2O2.2Li.2H/c1-10(2)4-8(11-6-13)3-9(5-10)12-7-14;;;;/h6-9H,3-5H2,1-2H3,(H,11,13)(H,12,14);;;;/q;2*+1;2*-1 |
| InChIKey | RESQAUIHJVCBLX-UHFFFAOYSA-N |
| XLogP | -5.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride?
The IUPAC name of dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride (CID 173289706) is dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride.
What is the SMILES notation for dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride?
The canonical SMILES for dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride is CC1(C)CC(NC=O)CC(NC=O)C1.[H-].[H-].[Li+].[Li+].
What is the InChIKey of dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride?
The InChIKey is RESQAUIHJVCBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2.2Li.2H/c1-10(2)4-8(11-6-13)3-9(5-10)12-7-14;;;;/h6-9H,3-5H2,1-2H3,(H,11,13)(H,12,14);;;;/q;2*+1;2*-1.
What are the key properties of dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride?
dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride has a molecular weight of 214.16 g/mol, XLogP of -5.34, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;N-(5-formamido-3,3-dimethylcyclohexyl)formamide;hydride is sourced from PubChem (CID 173289706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).