About 4-hydroxynon-2-enamide
4-hydroxynon-2-enamide (PubChem CID 173290647) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-hydroxynon-2-enamide.
Molecular Properties
| Compound Name | 4-hydroxynon-2-enamide |
| PubChem CID | 173290647 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-hydroxynon-2-enamide |
| SMILES | CCCCCC(O)C=CC(N)=O |
| InChI | InChI=1S/C9H17NO2/c1-2-3-4-5-8(11)6-7-9(10)12/h6-8,11H,2-5H2,1H3,(H2,10,12) |
| InChIKey | ZYSVYGHOSRDIEA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxynon-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxynon-2-enamide?
The IUPAC name of 4-hydroxynon-2-enamide (CID 173290647) is 4-hydroxynon-2-enamide.
What is the SMILES notation for 4-hydroxynon-2-enamide?
The canonical SMILES for 4-hydroxynon-2-enamide is CCCCCC(O)C=CC(N)=O.
What is the InChIKey of 4-hydroxynon-2-enamide?
The InChIKey is ZYSVYGHOSRDIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-3-4-5-8(11)6-7-9(10)12/h6-8,11H,2-5H2,1H3,(H2,10,12).
What are the key properties of 4-hydroxynon-2-enamide?
4-hydroxynon-2-enamide has a molecular weight of 171.24 g/mol, XLogP of 0.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxynon-2-enamide is sourced from PubChem (CID 173290647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).