C12H12OS — CID 173291828
3-(2,3-dimethylphenoxy)thiophene (PubChem CID 173291828) has the molecular formula C12H12OS and a molecular weight of 204.29 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)thiophene.
| Compound Name | 3-(2,3-dimethylphenoxy)thiophene |
|---|---|
| PubChem CID | 173291828 |
| Molecular Formula | C12H12OS |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)thiophene |
| SMILES | Cc1cccc(Oc2ccsc2)c1C |
| InChI | InChI=1S/C12H12OS/c1-9-4-3-5-12(10(9)2)13-11-6-7-14-8-11/h3-8H,1-2H3 |
| InChIKey | RJMWJKIRNPRJCQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |