C16H14ClN5O4 — CID 173291959
2-(6-chloro-3-pyridinyl)-4-methyl-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate (PubChem CID 173291959) has the molecular formula C16H14ClN5O4 and a molecular weight of 375.77 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-4-methyl-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate.
| Compound Name | 2-(6-chloro-3-pyridinyl)-4-methyl-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate |
|---|---|
| PubChem CID | 173291959 |
| Molecular Formula | C16H14ClN5O4 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-4-methyl-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate |
| SMILES | CC1=C([N+](=O)[O-])c2ccccc2N2NN(c3ccc(Cl)nc3)C(O)=C12.O |
| InChI | InChI=1S/C16H12ClN5O3.H2O/c1-9-14(22(24)25)11-4-2-3-5-12(11)21-15(9)16(23)20(19-21)10-6-7-13(17)18-8-10;/h2-8,19,23H,1H3;1H2 |
| InChIKey | LRSIHLAUCRSMOU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|