About 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate
2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate (PubChem CID 173292231) has the molecular formula C15H14ClN5O2
and a molecular weight of 331.76 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate.
Molecular Properties
| Compound Name | 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate |
| PubChem CID | 173292231 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate |
| SMILES | CC1=C2C(=O)N(c3ccc(Cl)nc3)NN2c2ccccc2N1.O |
| InChI | InChI=1S/C15H12ClN5O.H2O/c1-9-14-15(22)20(10-6-7-13(16)17-8-10)19-21(14)12-5-3-2-4-11(12)18-9;/h2-8,18-19H,1H3;1H2 |
| InChIKey | WNAHXQPLXQAIMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate?
The IUPAC name of 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate (CID 173292231) is 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate.
What is the SMILES notation for 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate?
The canonical SMILES for 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate is CC1=C2C(=O)N(c3ccc(Cl)nc3)NN2c2ccccc2N1.O.
What is the InChIKey of 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate?
The InChIKey is WNAHXQPLXQAIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN5O.H2O/c1-9-14-15(22)20(10-6-7-13(16)17-8-10)19-21(14)12-5-3-2-4-11(12)18-9;/h2-8,18-19H,1H3;1H2.
What are the key properties of 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate?
2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate has a molecular weight of 331.76 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3-pyridinyl)-4-methyl-1,5-dihydrotriazolo[1,5-a]quinoxalin-3-one;hydrate is sourced from PubChem (CID 173292231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).