C7H9NS — CID 173292254
3,5,6,7-tetrahydrothieno[3,4-c]pyridine (PubChem CID 173292254) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 3,5,6,7-tetrahydrothieno[3,4-c]pyridine.
| Compound Name | 3,5,6,7-tetrahydrothieno[3,4-c]pyridine |
|---|---|
| PubChem CID | 173292254 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3,5,6,7-tetrahydrothieno[3,4-c]pyridine |
| SMILES | C1=C2CCNC=C2CS1 |
| InChI | InChI=1S/C7H9NS/c1-2-8-3-7-5-9-4-6(1)7/h3-4,8H,1-2,5H2 |
| InChIKey | KZCSWSVKBUFNMD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |