About N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide
N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide (PubChem CID 173292448) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide |
| PubChem CID | 173292448 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(O)C1=CCCC=C1 |
| InChI | InChI=1S/C9H15NO3S/c1-14(12,13)10-7-9(11)8-5-3-2-4-6-8/h3,5-6,9-11H,2,4,7H2,1H3 |
| InChIKey | WSYVFZHSMHNQPK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide?
The IUPAC name of N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide (CID 173292448) is N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide.
What is the SMILES notation for N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide?
The canonical SMILES for N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide is CS(=O)(=O)NCC(O)C1=CCCC=C1.
What is the InChIKey of N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide?
The InChIKey is WSYVFZHSMHNQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S/c1-14(12,13)10-7-9(11)8-5-3-2-4-6-8/h3,5-6,9-11H,2,4,7H2,1H3.
What are the key properties of N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide?
N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide has a molecular weight of 217.29 g/mol, XLogP of 0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclohexa-1,5-dien-1-yl-2-hydroxyethyl)methanesulfonamide is sourced from PubChem (CID 173292448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).