About 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate
4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate (PubChem CID 173292579) has the molecular formula C17H17N5O4
and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate.
Molecular Properties
| Compound Name | 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate |
| PubChem CID | 173292579 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate |
| SMILES | CC1=C([N+](=O)[O-])c2ccccc2N2NN(c3ccc(C)nc3)C(O)=C12.O |
| InChI | InChI=1S/C17H15N5O3.H2O/c1-10-7-8-12(9-18-10)20-17(23)16-11(2)15(22(24)25)13-5-3-4-6-14(13)21(16)19-20;/h3-9,19,23H,1-2H3;1H2 |
| InChIKey | QQVKLICWWDAGTQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate?
The IUPAC name of 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate (CID 173292579) is 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate.
What is the SMILES notation for 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate?
The canonical SMILES for 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate is CC1=C([N+](=O)[O-])c2ccccc2N2NN(c3ccc(C)nc3)C(O)=C12.O.
What is the InChIKey of 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate?
The InChIKey is QQVKLICWWDAGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O3.H2O/c1-10-7-8-12(9-18-10)20-17(23)16-11(2)15(22(24)25)13-5-3-4-6-14(13)21(16)19-20;/h3-9,19,23H,1-2H3;1H2.
What are the key properties of 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate?
4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate has a molecular weight of 355.35 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(6-methyl-3-pyridinyl)-5-nitro-1H-triazolo[1,5-a]quinolin-3-ol;hydrate is sourced from PubChem (CID 173292579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).