About methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide
methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide (PubChem CID 173292602) has the molecular formula C8H19IN2O2S
and a molecular weight of 334.22 g/mol. Its IUPAC name is methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide |
| PubChem CID | 173292602 |
| Molecular Formula | C8H19IN2O2S |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide |
| SMILES | CCOC(C/N=C(/N)SC)OCC.I |
| InChI | InChI=1S/C8H18N2O2S.HI/c1-4-11-7(12-5-2)6-10-8(9)13-3;/h7H,4-6H2,1-3H3,(H2,9,10);1H |
| InChIKey | DOSUYWVGKBGTRU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide?
The IUPAC name of methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide (CID 173292602) is methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide.
What is the SMILES notation for methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide?
The canonical SMILES for methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide is CCOC(C/N=C(/N)SC)OCC.I.
What is the InChIKey of methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide?
The InChIKey is DOSUYWVGKBGTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2S.HI/c1-4-11-7(12-5-2)6-10-8(9)13-3;/h7H,4-6H2,1-3H3,(H2,9,10);1H.
What are the key properties of methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide?
methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide has a molecular weight of 334.22 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(2,2-diethoxyethyl)carbamimidothioate;hydroiodide is sourced from PubChem (CID 173292602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).