About potassium;hydride;propylsulfonyl but-2-enoate
potassium;hydride;propylsulfonyl but-2-enoate (PubChem CID 173292643) has the molecular formula C7H13KO4S
and a molecular weight of 232.34 g/mol. Its IUPAC name is potassium;hydride;propylsulfonyl but-2-enoate.
Molecular Properties
| Compound Name | potassium;hydride;propylsulfonyl but-2-enoate |
| PubChem CID | 173292643 |
| Molecular Formula | C7H13KO4S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | potassium;hydride;propylsulfonyl but-2-enoate |
| SMILES | CC=CC(=O)OS(=O)(=O)CCC.[H-].[K+] |
| InChI | InChI=1S/C7H12O4S.K.H/c1-3-5-7(8)11-12(9,10)6-4-2;;/h3,5H,4,6H2,1-2H3;;/q;+1;-1 |
| InChIKey | CESWIMYEQQIHCJ-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;propylsulfonyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;propylsulfonyl but-2-enoate?
The IUPAC name of potassium;hydride;propylsulfonyl but-2-enoate (CID 173292643) is potassium;hydride;propylsulfonyl but-2-enoate.
What is the SMILES notation for potassium;hydride;propylsulfonyl but-2-enoate?
The canonical SMILES for potassium;hydride;propylsulfonyl but-2-enoate is CC=CC(=O)OS(=O)(=O)CCC.[H-].[K+].
What is the InChIKey of potassium;hydride;propylsulfonyl but-2-enoate?
The InChIKey is CESWIMYEQQIHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S.K.H/c1-3-5-7(8)11-12(9,10)6-4-2;;/h3,5H,4,6H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;hydride;propylsulfonyl but-2-enoate?
potassium;hydride;propylsulfonyl but-2-enoate has a molecular weight of 232.34 g/mol, XLogP of -2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;propylsulfonyl but-2-enoate is sourced from PubChem (CID 173292643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).