About CID 173292676
CID 173292676 (PubChem CID 173292676) has the molecular formula HCl2Si2
and a molecular weight of 128.09 g/mol.
Molecular Properties
| Compound Name | CID 173292676 |
| PubChem CID | 173292676 |
| Molecular Formula | HCl2Si2 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 126.90 |
| IUPAC Name | — |
| SMILES | [Si][SiH](Cl)Cl |
| InChI | InChI=1S/Cl2HSi2/c1-4(2)3/h4H |
| InChIKey | TVQYPZCTQCYGKR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 173292676 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173292676?
The IUPAC name of CID 173292676 (CID 173292676) is not available.
What is the SMILES notation for CID 173292676?
The canonical SMILES for CID 173292676 is [Si][SiH](Cl)Cl.
What is the InChIKey of CID 173292676?
The InChIKey is TVQYPZCTQCYGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2HSi2/c1-4(2)3/h4H.
What are the key properties of CID 173292676?
CID 173292676 has a molecular weight of 128.09 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173292676 is sourced from PubChem (CID 173292676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).