C11H12F6 — CID 173293175
1-(2,2-dimethylpropyl)-2,3,4,5,5,6-hexafluorocyclohexa-1,3-diene (PubChem CID 173293175) has the molecular formula C11H12F6 and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2,3,4,5,5,6-hexafluorocyclohexa-1,3-diene.
| Compound Name | 1-(2,2-dimethylpropyl)-2,3,4,5,5,6-hexafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173293175 |
| Molecular Formula | C11H12F6 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2,3,4,5,5,6-hexafluorocyclohexa-1,3-diene |
| SMILES | CC(C)(C)CC1=C(F)C(F)=C(F)C(F)(F)C1F |
| InChI | InChI=1S/C11H12F6/c1-10(2,3)4-5-6(12)7(13)9(15)11(16,17)8(5)14/h8H,4H2,1-3H3 |
| InChIKey | SCSWWIOFSWLFDG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |