C16H32OSi — CID 173293934
[(1S)-1-tert-butyl-3,4,5,5-tetramethylcyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 173293934) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is [(1S)-1-tert-butyl-3,4,5,5-tetramethylcyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | [(1S)-1-tert-butyl-3,4,5,5-tetramethylcyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 173293934 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [(1S)-1-tert-butyl-3,4,5,5-tetramethylcyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | CC1=C(C)C(C)(C)C[C@](O[SiH](C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32OSi/c1-12-10-16(14(3,4)5,17-18(8)9)11-15(6,7)13(12)2/h18H,10-11H2,1-9H3/t16-/m0/s1 |
| InChIKey | RLNRBDOQTAZWOC-INIZCTEOSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|