C39H46N4NiO — CID 173295294
nickel;3-(2,3,7,8,10,12,13,15-octaethylporphyrin-5-yl)prop-2-enal (PubChem CID 173295294) has the molecular formula C39H46N4NiO and a molecular weight of 645.52 g/mol. Its IUPAC name is nickel;3-(2,3,7,8,10,12,13,15-octaethylporphyrin-5-yl)prop-2-enal.
| Compound Name | nickel;3-(2,3,7,8,10,12,13,15-octaethylporphyrin-5-yl)prop-2-enal |
|---|---|
| PubChem CID | 173295294 |
| Molecular Formula | C39H46N4NiO |
| Molecular Weight | 645.52 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | nickel;3-(2,3,7,8,10,12,13,15-octaethylporphyrin-5-yl)prop-2-enal |
| SMILES | CCC1=C(CC)/C2=C(\CC)C3=N/C(=C\C4=N/C(=C(C=CC=O)\C5=N/C(=C(/CC)C1=N2)C(CC)=C5CC)C(CC)=C4CC)C=C3.[Ni] |
| InChI | InChI=1S/C39H46N4O.Ni/c1-9-24-25(10-2)38-32(18-17-21-44)39-29(14-6)28(13-5)37(43-39)31(16-8)36-27(12-4)26(11-3)35(42-36)30(15-7)33-20-19-23(40-33)22-34(24)41-38;/h17-22H,9-16H2,1-8H3;/b18-17?,23-22-,33-30-,34-22-,35-30-,36-31-,37-31-,38-32-,39-32-; |
| InChIKey | AEPMTMXKSOWNOI-QBZQUYORSA-N |
| XLogP | 9.94 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.52 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|