About 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol
2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol (PubChem CID 173296294) has the molecular formula C8H20O3Si
and a molecular weight of 192.33 g/mol. Its IUPAC name is 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol.
Molecular Properties
| Compound Name | 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol |
| PubChem CID | 173296294 |
| Molecular Formula | C8H20O3Si |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol |
| SMILES | C[SiH](C)OC(O)(CO)C(C)(C)C |
| InChI | InChI=1S/C8H20O3Si/c1-7(2,3)8(10,6-9)11-12(4)5/h9-10,12H,6H2,1-5H3 |
| InChIKey | PYMMBKDHEBIRLZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol?
The IUPAC name of 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol (CID 173296294) is 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol.
What is the SMILES notation for 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol?
The canonical SMILES for 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol is C[SiH](C)OC(O)(CO)C(C)(C)C.
What is the InChIKey of 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol?
The InChIKey is PYMMBKDHEBIRLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O3Si/c1-7(2,3)8(10,6-9)11-12(4)5/h9-10,12H,6H2,1-5H3.
What are the key properties of 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol?
2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol has a molecular weight of 192.33 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilyloxy-3,3-dimethylbutane-1,2-diol is sourced from PubChem (CID 173296294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).