About 2-ethoxy-7-methylpurine
2-ethoxy-7-methylpurine (PubChem CID 173296379) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-ethoxy-7-methylpurine.
Molecular Properties
| Compound Name | 2-ethoxy-7-methylpurine |
| PubChem CID | 173296379 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-ethoxy-7-methylpurine |
| SMILES | CCOc1ncc2c(ncn2C)n1 |
| InChI | InChI=1S/C8H10N4O/c1-3-13-8-9-4-6-7(11-8)10-5-12(6)2/h4-5H,3H2,1-2H3 |
| InChIKey | UZYPLYIRZKEEKB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-7-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-7-methylpurine?
The IUPAC name of 2-ethoxy-7-methylpurine (CID 173296379) is 2-ethoxy-7-methylpurine.
What is the SMILES notation for 2-ethoxy-7-methylpurine?
The canonical SMILES for 2-ethoxy-7-methylpurine is CCOc1ncc2c(ncn2C)n1.
What is the InChIKey of 2-ethoxy-7-methylpurine?
The InChIKey is UZYPLYIRZKEEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-3-13-8-9-4-6-7(11-8)10-5-12(6)2/h4-5H,3H2,1-2H3.
What are the key properties of 2-ethoxy-7-methylpurine?
2-ethoxy-7-methylpurine has a molecular weight of 178.19 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-7-methylpurine is sourced from PubChem (CID 173296379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).