C22H16F2N4O — CID 173297141
3-amino-1-[5-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-(2,3-difluorophenyl)prop-2-en-1-one (PubChem CID 173297141) has the molecular formula C22H16F2N4O and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-amino-1-[5-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-(2,3-difluorophenyl)prop-2-en-1-one.
| Compound Name | 3-amino-1-[5-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-(2,3-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173297141 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-amino-1-[5-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-(2,3-difluorophenyl)prop-2-en-1-one |
| SMILES | NC=C(C(=O)c1c[nH]c2ncc(-c3ccc(N)cc3)cc12)c1cccc(F)c1F |
| InChI | InChI=1S/C22H16F2N4O/c23-19-3-1-2-15(20(19)24)17(9-25)21(29)18-11-28-22-16(18)8-13(10-27-22)12-4-6-14(26)7-5-12/h1-11H,25-26H2,(H,27,28) |
| InChIKey | ZQMJIRZEIJRLOZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|