C24H30O2 — CID 173297429
(2Z)-3-methyl-6-(1,1,3,3-tetramethyl-2,6,7,8-tetrahydrocyclopenta[g]naphthalen-5-ylidene)hexa-2,4-dienoic acid (PubChem CID 173297429) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2Z)-3-methyl-6-(1,1,3,3-tetramethyl-2,6,7,8-tetrahydrocyclopenta[g]naphthalen-5-ylidene)hexa-2,4-dienoic acid.
| Compound Name | (2Z)-3-methyl-6-(1,1,3,3-tetramethyl-2,6,7,8-tetrahydrocyclopenta[g]naphthalen-5-ylidene)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 173297429 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2Z)-3-methyl-6-(1,1,3,3-tetramethyl-2,6,7,8-tetrahydrocyclopenta[g]naphthalen-5-ylidene)hexa-2,4-dienoic acid |
| SMILES | C/C(C=CC=C1CCCc2cc3c(cc21)C(C)(C)CC3(C)C)=C/C(=O)O |
| InChI | InChI=1S/C24H30O2/c1-16(12-22(25)26)8-6-9-17-10-7-11-18-13-20-21(14-19(17)18)24(4,5)15-23(20,2)3/h6,8-9,12-14H,7,10-11,15H2,1-5H3,(H,25,26)/b8-6?,16-12-,17-9? |
| InChIKey | MNDGMYOHZGSXRZ-IKBFPIODSA-N |
| XLogP | 5.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|