C18H46NSi3+ — CID 173297681
tris[tert-butyl(dimethyl)silyl]azanium (PubChem CID 173297681) has the molecular formula C18H46NSi3+ and a molecular weight of 360.83 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl]azanium.
| Compound Name | tris[tert-butyl(dimethyl)silyl]azanium |
|---|---|
| PubChem CID | 173297681 |
| Molecular Formula | C18H46NSi3+ |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl]azanium |
| SMILES | CC(C)(C)[Si](C)(C)[NH+]([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H46NSi3/c1-16(2,3)20(10,11)19(21(12,13)17(4,5)6)22(14,15)18(7,8)9/h19H,1-15H3/q+1 |
| InChIKey | MPAJFMIOMFKPOB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|